C23H19BrFN3O2S2 — CID 19317192
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(4-bromo-2-fluorophenyl)acetamide (PubChem CID 19317192) has the molecular formula C23H19BrFN3O2S2 and a molecular weight of 532.46 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(4-bromo-2-fluorophenyl)acetamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(4-bromo-2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 19317192 |
| Molecular Formula | C23H19BrFN3O2S2 |
| Molecular Weight | 532.46 g/mol |
| Exact Mass | 531.01 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(4-bromo-2-fluorophenyl)acetamide |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2cccc(SCC(=O)Nc3ccc(Br)cc3F)c2)cc1 |
| InChI | InChI=1S/C23H19BrFN3O2S2/c1-14(29)15-5-8-17(9-6-15)26-23(31)27-18-3-2-4-19(12-18)32-13-22(30)28-21-10-7-16(24)11-20(21)25/h2-12H,13H2,1H3,(H,28,30)(H2,26,27,31) |
| InChIKey | AEMWKASEUYAKJR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.46 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|