C22H18BrFN2O2S — CID 18907055
N-[3-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylphenyl]-4-methylbenzamide (PubChem CID 18907055) has the molecular formula C22H18BrFN2O2S and a molecular weight of 473.37 g/mol. Its IUPAC name is N-[3-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylphenyl]-4-methylbenzamide.
| Compound Name | N-[3-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 18907055 |
| Molecular Formula | C22H18BrFN2O2S |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | N-[3-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylphenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(SCC(=O)Nc3ccc(Br)cc3F)c2)cc1 |
| InChI | InChI=1S/C22H18BrFN2O2S/c1-14-5-7-15(8-6-14)22(28)25-17-3-2-4-18(12-17)29-13-21(27)26-20-10-9-16(23)11-19(20)24/h2-12H,13H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | LKZQMQABNGQDRJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |