C22H19ClN2O2S — CID 18907057
N-[3-[2-(3-chloroanilino)-2-oxoethyl]sulfanylphenyl]-4-methylbenzamide (PubChem CID 18907057) has the molecular formula C22H19ClN2O2S and a molecular weight of 410.93 g/mol. Its IUPAC name is N-[3-[2-(3-chloroanilino)-2-oxoethyl]sulfanylphenyl]-4-methylbenzamide.
| Compound Name | N-[3-[2-(3-chloroanilino)-2-oxoethyl]sulfanylphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 18907057 |
| Molecular Formula | C22H19ClN2O2S |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-[3-[2-(3-chloroanilino)-2-oxoethyl]sulfanylphenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(SCC(=O)Nc3cccc(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C22H19ClN2O2S/c1-15-8-10-16(11-9-15)22(27)25-19-6-3-7-20(13-19)28-14-21(26)24-18-5-2-4-17(23)12-18/h2-13H,14H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | GLWZNXLGKPSWRS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |