C21H15BrF2N2O2S — CID 23097520
N-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylphenyl]-2-fluorobenzamide (PubChem CID 23097520) has the molecular formula C21H15BrF2N2O2S and a molecular weight of 477.33 g/mol. Its IUPAC name is N-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylphenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylphenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 23097520 |
| Molecular Formula | C21H15BrF2N2O2S |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | N-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylphenyl]-2-fluorobenzamide |
| SMILES | O=C(CSc1ccc(NC(=O)c2ccccc2F)cc1)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C21H15BrF2N2O2S/c22-13-5-10-19(18(24)11-13)26-20(27)12-29-15-8-6-14(7-9-15)25-21(28)16-3-1-2-4-17(16)23/h1-11H,12H2,(H,25,28)(H,26,27) |
| InChIKey | OJWUPGGDLVJJBE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |