C14H11BrFNOS — CID 2194605
2-(4-bromophenyl)sulfanyl-N-(2-fluorophenyl)acetamide (PubChem CID 2194605) has the molecular formula C14H11BrFNOS and a molecular weight of 340.22 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 2194605 |
| Molecular Formula | C14H11BrFNOS |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(CSc1ccc(Br)cc1)Nc1ccccc1F |
| InChI | InChI=1S/C14H11BrFNOS/c15-10-5-7-11(8-6-10)19-9-14(18)17-13-4-2-1-3-12(13)16/h1-8H,9H2,(H,17,18) |
| InChIKey | TUPOSZLYQQQWIG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |