C22H16ClFN2O4S — CID 23095254
4-chloro-3-[[2-[4-[(2-fluorobenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoic acid (PubChem CID 23095254) has the molecular formula C22H16ClFN2O4S and a molecular weight of 458.90 g/mol. Its IUPAC name is 4-chloro-3-[[2-[4-[(2-fluorobenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 4-chloro-3-[[2-[4-[(2-fluorobenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 23095254 |
| Molecular Formula | C22H16ClFN2O4S |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 4-chloro-3-[[2-[4-[(2-fluorobenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoic acid |
| SMILES | O=C(CSc1ccc(NC(=O)c2ccccc2F)cc1)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C22H16ClFN2O4S/c23-17-10-5-13(22(29)30)11-19(17)26-20(27)12-31-15-8-6-14(7-9-15)25-21(28)16-3-1-2-4-18(16)24/h1-11H,12H2,(H,25,28)(H,26,27)(H,29,30) |
| InChIKey | VLKOTXICSICIKF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |