C22H23ClN2O4S — CID 22782039
4-chloro-3-[[2-[4-(cyclohexanecarbonylamino)phenyl]sulfanylacetyl]amino]benzoic acid (PubChem CID 22782039) has the molecular formula C22H23ClN2O4S and a molecular weight of 446.96 g/mol. Its IUPAC name is 4-chloro-3-[[2-[4-(cyclohexanecarbonylamino)phenyl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 4-chloro-3-[[2-[4-(cyclohexanecarbonylamino)phenyl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22782039 |
| Molecular Formula | C22H23ClN2O4S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 4-chloro-3-[[2-[4-(cyclohexanecarbonylamino)phenyl]sulfanylacetyl]amino]benzoic acid |
| SMILES | O=C(CSc1ccc(NC(=O)C2CCCCC2)cc1)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C22H23ClN2O4S/c23-18-11-6-15(22(28)29)12-19(18)25-20(26)13-30-17-9-7-16(8-10-17)24-21(27)14-4-2-1-3-5-14/h6-12,14H,1-5,13H2,(H,24,27)(H,25,26)(H,28,29) |
| InChIKey | AMRYHCZFAAPECK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |