C15H18ClNO3S — CID 63118862
4-chloro-3-[[2-(cyclopentylmethylsulfanyl)acetyl]amino]benzoic acid (PubChem CID 63118862) has the molecular formula C15H18ClNO3S and a molecular weight of 327.83 g/mol. Its IUPAC name is 4-chloro-3-[[2-(cyclopentylmethylsulfanyl)acetyl]amino]benzoic acid.
| Compound Name | 4-chloro-3-[[2-(cyclopentylmethylsulfanyl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 63118862 |
| Molecular Formula | C15H18ClNO3S |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 4-chloro-3-[[2-(cyclopentylmethylsulfanyl)acetyl]amino]benzoic acid |
| SMILES | O=C(CSCC1CCCC1)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C15H18ClNO3S/c16-12-6-5-11(15(19)20)7-13(12)17-14(18)9-21-8-10-3-1-2-4-10/h5-7,10H,1-4,8-9H2,(H,17,18)(H,19,20) |
| InChIKey | LJCRIFCKJCASST-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |