C11H11ClN2O4S — CID 114231235
3-[[2-(2-amino-2-oxoethyl)sulfanylacetyl]amino]-4-chlorobenzoic acid (PubChem CID 114231235) has the molecular formula C11H11ClN2O4S and a molecular weight of 302.74 g/mol. Its IUPAC name is 3-[[2-(2-amino-2-oxoethyl)sulfanylacetyl]amino]-4-chlorobenzoic acid.
| Compound Name | 3-[[2-(2-amino-2-oxoethyl)sulfanylacetyl]amino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 114231235 |
| Molecular Formula | C11H11ClN2O4S |
| Molecular Weight | 302.74 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 3-[[2-(2-amino-2-oxoethyl)sulfanylacetyl]amino]-4-chlorobenzoic acid |
| SMILES | NC(=O)CSCC(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C11H11ClN2O4S/c12-7-2-1-6(11(17)18)3-8(7)14-10(16)5-19-4-9(13)15/h1-3H,4-5H2,(H2,13,15)(H,14,16)(H,17,18) |
| InChIKey | VYLGDOJPYSHHOK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.74 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |