C14H17ClN2O3S — CID 106429885
4-chloro-3-[[2-(2-prop-2-enylsulfanylethylamino)acetyl]amino]benzoic acid (PubChem CID 106429885) has the molecular formula C14H17ClN2O3S and a molecular weight of 328.82 g/mol. Its IUPAC name is 4-chloro-3-[[2-(2-prop-2-enylsulfanylethylamino)acetyl]amino]benzoic acid.
| Compound Name | 4-chloro-3-[[2-(2-prop-2-enylsulfanylethylamino)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 106429885 |
| Molecular Formula | C14H17ClN2O3S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4-chloro-3-[[2-(2-prop-2-enylsulfanylethylamino)acetyl]amino]benzoic acid |
| SMILES | C=CCSCCNCC(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C14H17ClN2O3S/c1-2-6-21-7-5-16-9-13(18)17-12-8-10(14(19)20)3-4-11(12)15/h2-4,8,16H,1,5-7,9H2,(H,17,18)(H,19,20) |
| InChIKey | ZQGKUMIZNCYMBD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|