C12H14ClN3O5 — CID 106178119
3-[[2-[(3-amino-2-hydroxy-3-oxopropyl)amino]acetyl]amino]-4-chlorobenzoic acid (PubChem CID 106178119) has the molecular formula C12H14ClN3O5 and a molecular weight of 315.71 g/mol. Its IUPAC name is 3-[[2-[(3-amino-2-hydroxy-3-oxopropyl)amino]acetyl]amino]-4-chlorobenzoic acid.
| Compound Name | 3-[[2-[(3-amino-2-hydroxy-3-oxopropyl)amino]acetyl]amino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 106178119 |
| Molecular Formula | C12H14ClN3O5 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 3-[[2-[(3-amino-2-hydroxy-3-oxopropyl)amino]acetyl]amino]-4-chlorobenzoic acid |
| SMILES | NC(=O)C(O)CNCC(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C12H14ClN3O5/c13-7-2-1-6(12(20)21)3-8(7)16-10(18)5-15-4-9(17)11(14)19/h1-3,9,15,17H,4-5H2,(H2,14,19)(H,16,18)(H,20,21) |
| InChIKey | VUQRDNCVBKWFQM-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |