C14H13ClN2O3S — CID 103237382
4-chloro-3-[[2-(thiophen-2-ylmethylamino)acetyl]amino]benzoic acid (PubChem CID 103237382) has the molecular formula C14H13ClN2O3S and a molecular weight of 324.79 g/mol. Its IUPAC name is 4-chloro-3-[[2-(thiophen-2-ylmethylamino)acetyl]amino]benzoic acid.
| Compound Name | 4-chloro-3-[[2-(thiophen-2-ylmethylamino)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 103237382 |
| Molecular Formula | C14H13ClN2O3S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 4-chloro-3-[[2-(thiophen-2-ylmethylamino)acetyl]amino]benzoic acid |
| SMILES | O=C(CNCc1cccs1)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C14H13ClN2O3S/c15-11-4-3-9(14(19)20)6-12(11)17-13(18)8-16-7-10-2-1-5-21-10/h1-6,16H,7-8H2,(H,17,18)(H,19,20) |
| InChIKey | BQVNUNSRSKCWJC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |