C15H17ClN2O3 — CID 106215260
4-chloro-3-[[2-(hex-5-ynylamino)acetyl]amino]benzoic acid (PubChem CID 106215260) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.76 g/mol. Its IUPAC name is 4-chloro-3-[[2-(hex-5-ynylamino)acetyl]amino]benzoic acid.
| Compound Name | 4-chloro-3-[[2-(hex-5-ynylamino)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 106215260 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-chloro-3-[[2-(hex-5-ynylamino)acetyl]amino]benzoic acid |
| SMILES | C#CCCCCNCC(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C15H17ClN2O3/c1-2-3-4-5-8-17-10-14(19)18-13-9-11(15(20)21)6-7-12(13)16/h1,6-7,9,17H,3-5,8,10H2,(H,18,19)(H,20,21) |
| InChIKey | NGVDULYSLRGVEH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|