C14H19ClN2O3S — CID 103251048
4-chloro-3-[[2-[(2-methyl-3-methylsulfanylpropyl)amino]acetyl]amino]benzoic acid (PubChem CID 103251048) has the molecular formula C14H19ClN2O3S and a molecular weight of 330.84 g/mol. Its IUPAC name is 4-chloro-3-[[2-[(2-methyl-3-methylsulfanylpropyl)amino]acetyl]amino]benzoic acid.
| Compound Name | 4-chloro-3-[[2-[(2-methyl-3-methylsulfanylpropyl)amino]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 103251048 |
| Molecular Formula | C14H19ClN2O3S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 4-chloro-3-[[2-[(2-methyl-3-methylsulfanylpropyl)amino]acetyl]amino]benzoic acid |
| SMILES | CSCC(C)CNCC(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C14H19ClN2O3S/c1-9(8-21-2)6-16-7-13(18)17-12-5-10(14(19)20)3-4-11(12)15/h3-5,9,16H,6-8H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | USPZVBNXLXERIL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |