C12H14Cl2N2OS — CID 66289696
2-(azetidin-3-ylmethylsulfanyl)-N-(2,5-dichlorophenyl)acetamide (PubChem CID 66289696) has the molecular formula C12H14Cl2N2OS and a molecular weight of 305.23 g/mol. Its IUPAC name is 2-(azetidin-3-ylmethylsulfanyl)-N-(2,5-dichlorophenyl)acetamide.
| Compound Name | 2-(azetidin-3-ylmethylsulfanyl)-N-(2,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 66289696 |
| Molecular Formula | C12H14Cl2N2OS |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2-(azetidin-3-ylmethylsulfanyl)-N-(2,5-dichlorophenyl)acetamide |
| SMILES | O=C(CSCC1CNC1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H14Cl2N2OS/c13-9-1-2-10(14)11(3-9)16-12(17)7-18-6-8-4-15-5-8/h1-3,8,15H,4-7H2,(H,16,17) |
| InChIKey | RXUQAPZPLMSTEX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |