C12H14BrFN2OS — CID 66289258
2-(azetidin-3-ylmethylsulfanyl)-N-(4-bromo-2-fluorophenyl)acetamide (PubChem CID 66289258) has the molecular formula C12H14BrFN2OS and a molecular weight of 333.23 g/mol. Its IUPAC name is 2-(azetidin-3-ylmethylsulfanyl)-N-(4-bromo-2-fluorophenyl)acetamide.
| Compound Name | 2-(azetidin-3-ylmethylsulfanyl)-N-(4-bromo-2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 66289258 |
| Molecular Formula | C12H14BrFN2OS |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 2-(azetidin-3-ylmethylsulfanyl)-N-(4-bromo-2-fluorophenyl)acetamide |
| SMILES | O=C(CSCC1CNC1)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C12H14BrFN2OS/c13-9-1-2-11(10(14)3-9)16-12(17)7-18-6-8-4-15-5-8/h1-3,8,15H,4-7H2,(H,16,17) |
| InChIKey | SJMJXFUNOLWJFB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |