C12H16BrFN2OS — CID 66230883
2-(2-amino-2-methylpropyl)sulfanyl-N-(4-bromo-2-fluorophenyl)acetamide (PubChem CID 66230883) has the molecular formula C12H16BrFN2OS and a molecular weight of 335.24 g/mol. Its IUPAC name is 2-(2-amino-2-methylpropyl)sulfanyl-N-(4-bromo-2-fluorophenyl)acetamide.
| Compound Name | 2-(2-amino-2-methylpropyl)sulfanyl-N-(4-bromo-2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 66230883 |
| Molecular Formula | C12H16BrFN2OS |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 2-(2-amino-2-methylpropyl)sulfanyl-N-(4-bromo-2-fluorophenyl)acetamide |
| SMILES | CC(C)(N)CSCC(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C12H16BrFN2OS/c1-12(2,15)7-18-6-11(17)16-10-4-3-8(13)5-9(10)14/h3-5H,6-7,15H2,1-2H3,(H,16,17) |
| InChIKey | TZGNFTOLSHTTHI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |