C23H26N2O4S — CID 22778483
3-[[2-[4-(cyclohexanecarbonylamino)phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid (PubChem CID 22778483) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is 3-[[2-[4-(cyclohexanecarbonylamino)phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid.
| Compound Name | 3-[[2-[4-(cyclohexanecarbonylamino)phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 22778483 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 3-[[2-[4-(cyclohexanecarbonylamino)phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)CSc1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H26N2O4S/c1-15-7-8-17(23(28)29)13-20(15)25-21(26)14-30-19-11-9-18(10-12-19)24-22(27)16-5-3-2-4-6-16/h7-13,16H,2-6,14H2,1H3,(H,24,27)(H,25,26)(H,28,29) |
| InChIKey | OCUNEWSHMVEBMC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |