C15H13ClFN3O2 — CID 39184440
N-[3-[(2-aminoacetyl)amino]-4-chlorophenyl]-2-fluorobenzamide (PubChem CID 39184440) has the molecular formula C15H13ClFN3O2 and a molecular weight of 321.74 g/mol. Its IUPAC name is N-[3-[(2-aminoacetyl)amino]-4-chlorophenyl]-2-fluorobenzamide.
| Compound Name | N-[3-[(2-aminoacetyl)amino]-4-chlorophenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 39184440 |
| Molecular Formula | C15H13ClFN3O2 |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[3-[(2-aminoacetyl)amino]-4-chlorophenyl]-2-fluorobenzamide |
| SMILES | NCC(=O)Nc1cc(NC(=O)c2ccccc2F)ccc1Cl |
| InChI | InChI=1S/C15H13ClFN3O2/c16-11-6-5-9(7-13(11)20-14(21)8-18)19-15(22)10-3-1-2-4-12(10)17/h1-7H,8,18H2,(H,19,22)(H,20,21) |
| InChIKey | MWJIHHABFXPIKY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |