C11H13Cl2N3O2 — CID 82034449
3-amino-N-[4-chloro-3-[(2-chloroacetyl)amino]phenyl]propanamide (PubChem CID 82034449) has the molecular formula C11H13Cl2N3O2 and a molecular weight of 290.15 g/mol. Its IUPAC name is 3-amino-N-[4-chloro-3-[(2-chloroacetyl)amino]phenyl]propanamide.
| Compound Name | 3-amino-N-[4-chloro-3-[(2-chloroacetyl)amino]phenyl]propanamide |
|---|---|
| PubChem CID | 82034449 |
| Molecular Formula | C11H13Cl2N3O2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 3-amino-N-[4-chloro-3-[(2-chloroacetyl)amino]phenyl]propanamide |
| SMILES | NCCC(=O)Nc1ccc(Cl)c(NC(=O)CCl)c1 |
| InChI | InChI=1S/C11H13Cl2N3O2/c12-6-11(18)16-9-5-7(1-2-8(9)13)15-10(17)3-4-14/h1-2,5H,3-4,6,14H2,(H,15,17)(H,16,18) |
| InChIKey | WJZZPHQGDZYKSZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|