C15H16ClN3O3 — CID 39193126
N-[3-(4-aminobutanoylamino)-4-chlorophenyl]furan-2-carboxamide (PubChem CID 39193126) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is N-[3-(4-aminobutanoylamino)-4-chlorophenyl]furan-2-carboxamide.
| Compound Name | N-[3-(4-aminobutanoylamino)-4-chlorophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39193126 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-[3-(4-aminobutanoylamino)-4-chlorophenyl]furan-2-carboxamide |
| SMILES | NCCCC(=O)Nc1cc(NC(=O)c2ccco2)ccc1Cl |
| InChI | InChI=1S/C15H16ClN3O3/c16-11-6-5-10(18-15(21)13-3-2-8-22-13)9-12(11)19-14(20)4-1-7-17/h2-3,5-6,8-9H,1,4,7,17H2,(H,18,21)(H,19,20) |
| InChIKey | JCNLAOOTABZKPO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |