C16H17ClN4O2 — CID 39193137
N-[3-(4-aminobutanoylamino)-4-chlorophenyl]pyridine-4-carboxamide (PubChem CID 39193137) has the molecular formula C16H17ClN4O2 and a molecular weight of 332.79 g/mol. Its IUPAC name is N-[3-(4-aminobutanoylamino)-4-chlorophenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-(4-aminobutanoylamino)-4-chlorophenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 39193137 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-[3-(4-aminobutanoylamino)-4-chlorophenyl]pyridine-4-carboxamide |
| SMILES | NCCCC(=O)Nc1cc(NC(=O)c2ccncc2)ccc1Cl |
| InChI | InChI=1S/C16H17ClN4O2/c17-13-4-3-12(10-14(13)21-15(22)2-1-7-18)20-16(23)11-5-8-19-9-6-11/h3-6,8-10H,1-2,7,18H2,(H,20,23)(H,21,22) |
| InChIKey | UXBHYGWPWHYBDR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |