C15H23Cl2N3O2 — CID 119707605
N-(5-acetamido-2-chlorophenyl)-7-aminoheptanamide;hydrochloride (PubChem CID 119707605) has the molecular formula C15H23Cl2N3O2 and a molecular weight of 348.27 g/mol. Its IUPAC name is N-(5-acetamido-2-chlorophenyl)-7-aminoheptanamide;hydrochloride.
| Compound Name | N-(5-acetamido-2-chlorophenyl)-7-aminoheptanamide;hydrochloride |
|---|---|
| PubChem CID | 119707605 |
| Molecular Formula | C15H23Cl2N3O2 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N-(5-acetamido-2-chlorophenyl)-7-aminoheptanamide;hydrochloride |
| SMILES | CC(=O)Nc1ccc(Cl)c(NC(=O)CCCCCCN)c1.Cl |
| InChI | InChI=1S/C15H22ClN3O2.ClH/c1-11(20)18-12-7-8-13(16)14(10-12)19-15(21)6-4-2-3-5-9-17;/h7-8,10H,2-6,9,17H2,1H3,(H,18,20)(H,19,21);1H |
| InChIKey | FHFLJKABSBIZGU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|