C10H13Cl3N2O — CID 119262031
4-amino-N-(3,4-dichlorophenyl)butanamide;hydrochloride (PubChem CID 119262031) has the molecular formula C10H13Cl3N2O and a molecular weight of 283.59 g/mol. Its IUPAC name is 4-amino-N-(3,4-dichlorophenyl)butanamide;hydrochloride.
| Compound Name | 4-amino-N-(3,4-dichlorophenyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119262031 |
| Molecular Formula | C10H13Cl3N2O |
| Molecular Weight | 283.59 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 4-amino-N-(3,4-dichlorophenyl)butanamide;hydrochloride |
| SMILES | Cl.NCCCC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2N2O.ClH/c11-8-4-3-7(6-9(8)12)14-10(15)2-1-5-13;/h3-4,6H,1-2,5,13H2,(H,14,15);1H |
| InChIKey | REHFADKVOBLJEU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |