C12H18Cl2N2O2S — CID 119327327
4-amino-N-[4-chloro-3-(methylsulfinylmethyl)phenyl]butanamide;hydrochloride (PubChem CID 119327327) has the molecular formula C12H18Cl2N2O2S and a molecular weight of 325.26 g/mol. Its IUPAC name is 4-amino-N-[4-chloro-3-(methylsulfinylmethyl)phenyl]butanamide;hydrochloride.
| Compound Name | 4-amino-N-[4-chloro-3-(methylsulfinylmethyl)phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119327327 |
| Molecular Formula | C12H18Cl2N2O2S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 4-amino-N-[4-chloro-3-(methylsulfinylmethyl)phenyl]butanamide;hydrochloride |
| SMILES | CS(=O)Cc1cc(NC(=O)CCCN)ccc1Cl.Cl |
| InChI | InChI=1S/C12H17ClN2O2S.ClH/c1-18(17)8-9-7-10(4-5-11(9)13)15-12(16)3-2-6-14;/h4-5,7H,2-3,6,8,14H2,1H3,(H,15,16);1H |
| InChIKey | HEYWRKISDCRMJW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |