C16H20ClN3O3 — CID 119300225
N-[4-(4-aminobutanoylamino)-2-methylphenyl]furan-2-carboxamide;hydrochloride (PubChem CID 119300225) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is N-[4-(4-aminobutanoylamino)-2-methylphenyl]furan-2-carboxamide;hydrochloride.
| Compound Name | N-[4-(4-aminobutanoylamino)-2-methylphenyl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119300225 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-[4-(4-aminobutanoylamino)-2-methylphenyl]furan-2-carboxamide;hydrochloride |
| SMILES | Cc1cc(NC(=O)CCCN)ccc1NC(=O)c1ccco1.Cl |
| InChI | InChI=1S/C16H19N3O3.ClH/c1-11-10-12(18-15(20)5-2-8-17)6-7-13(11)19-16(21)14-4-3-9-22-14;/h3-4,6-7,9-10H,2,5,8,17H2,1H3,(H,18,20)(H,19,21);1H |
| InChIKey | AOEQJMUTPZFVMR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |