C19H14BrFN2O3S — CID 22782329
N-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylphenyl]furan-2-carboxamide (PubChem CID 22782329) has the molecular formula C19H14BrFN2O3S and a molecular weight of 449.30 g/mol. Its IUPAC name is N-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylphenyl]furan-2-carboxamide.
| Compound Name | N-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 22782329 |
| Molecular Formula | C19H14BrFN2O3S |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 447.99 |
| IUPAC Name | N-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylphenyl]furan-2-carboxamide |
| SMILES | O=C(CSc1ccc(NC(=O)c2ccco2)cc1)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C19H14BrFN2O3S/c20-12-3-8-16(15(21)10-12)23-18(24)11-27-14-6-4-13(5-7-14)22-19(25)17-2-1-9-26-17/h1-10H,11H2,(H,22,25)(H,23,24) |
| InChIKey | FWBIFCFHOYLVTA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |