C18H14BrFN2O4S — CID 18896771
(E)-4-[3-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 18896771) has the molecular formula C18H14BrFN2O4S and a molecular weight of 453.29 g/mol. Its IUPAC name is (E)-4-[3-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 18896771 |
| Molecular Formula | C18H14BrFN2O4S |
| Molecular Weight | 453.29 g/mol |
| Exact Mass | 451.98 |
| IUPAC Name | (E)-4-[3-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1cccc(SCC(=O)Nc2ccc(Br)cc2F)c1 |
| InChI | InChI=1S/C18H14BrFN2O4S/c19-11-4-5-15(14(20)8-11)22-17(24)10-27-13-3-1-2-12(9-13)21-16(23)6-7-18(25)26/h1-9H,10H2,(H,21,23)(H,22,24)(H,25,26)/b7-6+ |
| InChIKey | FQNYOJQGWFSKMJ-VOTSOKGWSA-N |
| XLogP | 3.90 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|