C27H20N4O6S2 — CID 18895389
(E)-4-[3-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 18895389) has the molecular formula C27H20N4O6S2 and a molecular weight of 560.61 g/mol. Its IUPAC name is (E)-4-[3-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 18895389 |
| Molecular Formula | C27H20N4O6S2 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.08 |
| IUPAC Name | (E)-4-[3-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1cccc(SC(C(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H20N4O6S2/c32-23(12-13-24(33)34)28-19-9-5-11-21(15-19)39-25(17-6-2-1-3-7-17)26(35)30-27-29-22(16-38-27)18-8-4-10-20(14-18)31(36)37/h1-16,25H,(H,28,32)(H,33,34)(H,29,30,35)/b13-12+ |
| InChIKey | PLDAXAGTWOHASQ-OUKQBFOZSA-N |
| XLogP | 5.77 |
| TPSA | 151.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|