C27H20BrN3O4S2 — CID 19713272
(E)-4-[4-[2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 19713272) has the molecular formula C27H20BrN3O4S2 and a molecular weight of 594.51 g/mol. Its IUPAC name is (E)-4-[4-[2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 19713272 |
| Molecular Formula | C27H20BrN3O4S2 |
| Molecular Weight | 594.51 g/mol |
| Exact Mass | 593.01 |
| IUPAC Name | (E)-4-[4-[2-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccc(SC(C(=O)Nc2nc(-c3ccc(Br)cc3)cs2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H20BrN3O4S2/c28-19-8-6-17(7-9-19)22-16-36-27(30-22)31-26(35)25(18-4-2-1-3-5-18)37-21-12-10-20(11-13-21)29-23(32)14-15-24(33)34/h1-16,25H,(H,29,32)(H,33,34)(H,30,31,35)/b15-14+ |
| InChIKey | QJBOOMPRSPLLEV-CCEZHUSRSA-N |
| XLogP | 6.62 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.51 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|