C28H23N3O5S2 — CID 19713276
(E)-4-[4-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 19713276) has the molecular formula C28H23N3O5S2 and a molecular weight of 545.64 g/mol. Its IUPAC name is (E)-4-[4-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 19713276 |
| Molecular Formula | C28H23N3O5S2 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | (E)-4-[4-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | COc1ccccc1-c1csc(NC(=O)C(Sc2ccc(NC(=O)/C=C/C(=O)O)cc2)c2ccccc2)n1 |
| InChI | InChI=1S/C28H23N3O5S2/c1-36-23-10-6-5-9-21(23)22-17-37-28(30-22)31-27(35)26(18-7-3-2-4-8-18)38-20-13-11-19(12-14-20)29-24(32)15-16-25(33)34/h2-17,26H,1H3,(H,29,32)(H,33,34)(H,30,31,35)/b16-15+ |
| InChIKey | PGAKNLAORFFMDD-FOCLMDBBSA-N |
| XLogP | 5.87 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|