C33H27N3O3S2 — CID 18899270
(E)-N-[3-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide (PubChem CID 18899270) has the molecular formula C33H27N3O3S2 and a molecular weight of 577.73 g/mol. Its IUPAC name is (E)-N-[3-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[3-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 18899270 |
| Molecular Formula | C33H27N3O3S2 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | (E)-N-[3-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
| SMILES | COc1ccccc1-c1csc(NC(=O)C(Sc2cccc(NC(=O)/C=C/c3ccccc3)c2)c2ccccc2)n1 |
| InChI | InChI=1S/C33H27N3O3S2/c1-39-29-18-9-8-17-27(29)28-22-40-33(35-28)36-32(38)31(24-13-6-3-7-14-24)41-26-16-10-15-25(21-26)34-30(37)20-19-23-11-4-2-5-12-23/h2-22,31H,1H3,(H,34,37)(H,35,36,38)/b20-19+ |
| InChIKey | HQPQYWNLDYNREL-FMQUCBEESA-N |
| XLogP | 7.94 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|