C28H25N3O4S2 — CID 18899225
(E)-N-[3-[2-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide (PubChem CID 18899225) has the molecular formula C28H25N3O4S2 and a molecular weight of 531.66 g/mol. Its IUPAC name is (E)-N-[3-[2-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[3-[2-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 18899225 |
| Molecular Formula | C28H25N3O4S2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | (E)-N-[3-[2-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
| SMILES | COc1ccc(-c2csc(NC(=O)CSc3cccc(NC(=O)/C=C/c4ccccc4)c3)n2)cc1OC |
| InChI | InChI=1S/C28H25N3O4S2/c1-34-24-13-12-20(15-25(24)35-2)23-17-37-28(30-23)31-27(33)18-36-22-10-6-9-21(16-22)29-26(32)14-11-19-7-4-3-5-8-19/h3-17H,18H2,1-2H3,(H,29,32)(H,30,31,33)/b14-11+ |
| InChIKey | HUZUNOJUFYTGNF-SDNWHVSQSA-N |
| XLogP | 6.21 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|