C21H18FN3O3S — CID 55437889
(E)-N-[2-[[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-3-phenylprop-2-enamide (PubChem CID 55437889) has the molecular formula C21H18FN3O3S and a molecular weight of 411.46 g/mol. Its IUPAC name is (E)-N-[2-[[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 55437889 |
| Molecular Formula | C21H18FN3O3S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (E)-N-[2-[[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-3-phenylprop-2-enamide |
| SMILES | COc1ccc(-c2csc(NC(=O)CNC(=O)/C=C/c3ccccc3)n2)cc1F |
| InChI | InChI=1S/C21H18FN3O3S/c1-28-18-9-8-15(11-16(18)22)17-13-29-21(24-17)25-20(27)12-23-19(26)10-7-14-5-3-2-4-6-14/h2-11,13H,12H2,1H3,(H,23,26)(H,24,25,27)/b10-7+ |
| InChIKey | QOJRFUNPDFVZHU-JXMROGBWSA-N |
| XLogP | 3.73 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|