C21H20N4O4S2 — CID 55560645
(E)-N-[2-[[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]-3-phenylprop-2-enamide (PubChem CID 55560645) has the molecular formula C21H20N4O4S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is (E)-N-[2-[[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 55560645 |
| Molecular Formula | C21H20N4O4S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | (E)-N-[2-[[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]-3-phenylprop-2-enamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2csc(NC(=O)CNC(=O)/C=C/c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H20N4O4S2/c1-31(28,29)25-17-10-8-16(9-11-17)18-14-30-21(23-18)24-20(27)13-22-19(26)12-7-15-5-3-2-4-6-15/h2-12,14,25H,13H2,1H3,(H,22,26)(H,23,24,27)/b12-7+ |
| InChIKey | CUQVHRVWYHIJGS-KPKJPENVSA-N |
| XLogP | 2.95 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|