C16H15N3O2S2 — CID 9330073
N-[4-(2-anilino-1,3-thiazol-4-yl)phenyl]methanesulfonamide (PubChem CID 9330073) has the molecular formula C16H15N3O2S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is N-[4-(2-anilino-1,3-thiazol-4-yl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(2-anilino-1,3-thiazol-4-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 9330073 |
| Molecular Formula | C16H15N3O2S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-[4-(2-anilino-1,3-thiazol-4-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2csc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C16H15N3O2S2/c1-23(20,21)19-14-9-7-12(8-10-14)15-11-22-16(18-15)17-13-5-3-2-4-6-13/h2-11,19H,1H3,(H,17,18) |
| InChIKey | STWCAVHMRVGMBH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |