C40H31N5O6S2 — CID 22192580
N-[(Z)-3-[4-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22192580) has the molecular formula C40H31N5O6S2 and a molecular weight of 741.85 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22192580 |
| Molecular Formula | C40H31N5O6S2 |
| Molecular Weight | 741.85 g/mol |
| Exact Mass | 741.17 |
| IUPAC Name | N-[(Z)-3-[4-[2-[[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccccc1-c1csc(NC(=O)C(Sc2ccc(NC(=O)/C(=C/c3ccc([N+](=O)[O-])cc3)NC(=O)c3ccccc3)cc2)c2ccccc2)n1 |
| InChI | InChI=1S/C40H31N5O6S2/c1-51-35-15-9-8-14-32(35)34-25-52-40(43-34)44-39(48)36(27-10-4-2-5-11-27)53-31-22-18-29(19-23-31)41-38(47)33(42-37(46)28-12-6-3-7-13-28)24-26-16-20-30(21-17-26)45(49)50/h2-25,36H,1H3,(H,41,47)(H,42,46)(H,43,44,48)/b33-24- |
| InChIKey | UECWICASJBKKBF-GIBOGKFOSA-N |
| XLogP | 8.61 |
| TPSA | 152.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.85 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|