C41H33N5O7S2 — CID 22191873
N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22191873) has the molecular formula C41H33N5O7S2 and a molecular weight of 771.88 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22191873 |
| Molecular Formula | C41H33N5O7S2 |
| Molecular Weight | 771.88 g/mol |
| Exact Mass | 771.18 |
| IUPAC Name | N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3nc(-c4cccc([N+](=O)[O-])c4)cs3)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C41H33N5O7S2/c1-52-32-18-21-36(53-2)29(23-32)24-34(43-38(47)27-12-7-4-8-13-27)39(48)42-30-16-19-33(20-17-30)55-37(26-10-5-3-6-11-26)40(49)45-41-44-35(25-54-41)28-14-9-15-31(22-28)46(50)51/h3-25,37H,1-2H3,(H,42,48)(H,43,47)(H,44,45,49)/b34-24- |
| InChIKey | AQUZAOSXUKKPNU-BCJTWVECSA-N |
| XLogP | 8.62 |
| TPSA | 161.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.88 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|