C42H35N5O8S2 — CID 22193007
N-[(Z)-3-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22193007) has the molecular formula C42H35N5O8S2 and a molecular weight of 801.90 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22193007 |
| Molecular Formula | C42H35N5O8S2 |
| Molecular Weight | 801.90 g/mol |
| Exact Mass | 801.19 |
| IUPAC Name | N-[(Z)-3-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(SC(C(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H35N5O8S2/c1-53-35-24-37(55-3)36(54-2)23-29(35)22-33(44-39(48)27-13-8-5-9-14-27)40(49)43-30-17-19-32(20-18-30)57-38(26-11-6-4-7-12-26)41(50)46-42-45-34(25-56-42)28-15-10-16-31(21-28)47(51)52/h4-25,38H,1-3H3,(H,43,49)(H,44,48)(H,45,46,50)/b33-22- |
| InChIKey | PYCJBDXQVNOMHM-NVMPUMLXSA-N |
| XLogP | 8.63 |
| TPSA | 171.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.90 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|