C40H36N4O8S — CID 22190373
N-[(Z)-3-[4-[2-(2-methyl-5-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22190373) has the molecular formula C40H36N4O8S and a molecular weight of 732.82 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(2-methyl-5-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(2-methyl-5-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22190373 |
| Molecular Formula | C40H36N4O8S |
| Molecular Weight | 732.82 g/mol |
| Exact Mass | 732.23 |
| IUPAC Name | N-[(Z)-3-[4-[2-(2-methyl-5-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(SC(C(=O)Nc2cc([N+](=O)[O-])ccc2C)c2ccccc2)cc1 |
| InChI | InChI=1S/C40H36N4O8S/c1-25-15-18-30(44(48)49)23-32(25)42-40(47)37(26-11-7-5-8-12-26)53-31-19-16-29(17-20-31)41-39(46)33(43-38(45)27-13-9-6-10-14-27)21-28-22-35(51-3)36(52-4)24-34(28)50-2/h5-24,37H,1-4H3,(H,41,46)(H,42,47)(H,43,45)/b33-21- |
| InChIKey | XZQGDFYICHWXTR-HWIUFGAZSA-N |
| XLogP | 7.81 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.82 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|