C35H34N4O8S — CID 22190233
N-[(Z)-3-[4-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22190233) has the molecular formula C35H34N4O8S and a molecular weight of 670.74 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22190233 |
| Molecular Formula | C35H34N4O8S |
| Molecular Weight | 670.74 g/mol |
| Exact Mass | 670.21 |
| IUPAC Name | N-[(Z)-3-[4-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(SC(C)C(=O)Nc2cc([N+](=O)[O-])ccc2C)cc1 |
| InChI | InChI=1S/C35H34N4O8S/c1-21-11-14-26(39(43)44)19-28(21)37-33(40)22(2)48-27-15-12-25(13-16-27)36-35(42)29(38-34(41)23-9-7-6-8-10-23)17-24-18-31(46-4)32(47-5)20-30(24)45-3/h6-20,22H,1-5H3,(H,36,42)(H,37,40)(H,38,41)/b29-17- |
| InChIKey | AGNWGLJHTPAGGC-RHANQZHGSA-N |
| XLogP | 6.46 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.74 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|