C39H27ClFN5O5S2 — CID 22191333
N-[(Z)-1-(2-chloro-6-fluorophenyl)-3-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22191333) has the molecular formula C39H27ClFN5O5S2 and a molecular weight of 764.26 g/mol. Its IUPAC name is N-[(Z)-1-(2-chloro-6-fluorophenyl)-3-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-chloro-6-fluorophenyl)-3-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22191333 |
| Molecular Formula | C39H27ClFN5O5S2 |
| Molecular Weight | 764.26 g/mol |
| Exact Mass | 763.11 |
| IUPAC Name | N-[(Z)-1-(2-chloro-6-fluorophenyl)-3-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)c2ccccc2)cc1)/C(=C/c1c(F)cccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C39H27ClFN5O5S2/c40-31-15-8-16-32(41)30(31)22-33(43-36(47)25-11-5-2-6-12-25)37(48)42-27-17-19-29(20-18-27)53-35(24-9-3-1-4-10-24)38(49)45-39-44-34(23-52-39)26-13-7-14-28(21-26)46(50)51/h1-23,35H,(H,42,48)(H,43,47)(H,44,45,49)/b33-22- |
| InChIKey | FCOMDAPAEKJAOK-NVMPUMLXSA-N |
| XLogP | 9.39 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.26 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|