C43H39N5O5S2 — CID 22191977
N-[(Z)-3-[4-[2-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22191977) has the molecular formula C43H39N5O5S2 and a molecular weight of 769.95 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22191977 |
| Molecular Formula | C43H39N5O5S2 |
| Molecular Weight | 769.95 g/mol |
| Exact Mass | 769.24 |
| IUPAC Name | N-[(Z)-3-[4-[2-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(-c2csc(NC(=O)C(Sc3ccc(NC(=O)/C(=C/c4ccc(N(C)C)cc4)NC(=O)c4ccccc4)cc3)c3ccccc3)n2)cc1OC |
| InChI | InChI=1S/C43H39N5O5S2/c1-48(2)33-20-15-28(16-21-33)25-35(45-40(49)30-13-9-6-10-14-30)41(50)44-32-18-22-34(23-19-32)55-39(29-11-7-5-8-12-29)42(51)47-43-46-36(27-54-43)31-17-24-37(52-3)38(26-31)53-4/h5-27,39H,1-4H3,(H,44,50)(H,45,49)(H,46,47,51)/b35-25- |
| InChIKey | XSCIDVLNQQDEFE-CKWSZQMZSA-N |
| XLogP | 8.77 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.95 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|