C39H33N5O3S3 — CID 22191983
N-[(Z)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[4-[2-oxo-1-phenyl-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 22191983) has the molecular formula C39H33N5O3S3 and a molecular weight of 715.93 g/mol. Its IUPAC name is N-[(Z)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[4-[2-oxo-1-phenyl-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[4-[2-oxo-1-phenyl-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22191983 |
| Molecular Formula | C39H33N5O3S3 |
| Molecular Weight | 715.93 g/mol |
| Exact Mass | 715.17 |
| IUPAC Name | N-[(Z)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[4-[2-oxo-1-phenyl-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CN(C)c1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3nc(-c4cccs4)cs3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C39H33N5O3S3/c1-44(2)30-19-15-26(16-20-30)24-32(41-36(45)28-12-7-4-8-13-28)37(46)40-29-17-21-31(22-18-29)50-35(27-10-5-3-6-11-27)38(47)43-39-42-33(25-49-39)34-14-9-23-48-34/h3-25,35H,1-2H3,(H,40,46)(H,41,45)(H,42,43,47)/b32-24- |
| InChIKey | FHKYQONQKMXIGS-TZHWMEPESA-N |
| XLogP | 8.82 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.93 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|