C31H24N4O5S2 — CID 18900060
N-[3-[2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide (PubChem CID 18900060) has the molecular formula C31H24N4O5S2 and a molecular weight of 596.69 g/mol. Its IUPAC name is N-[3-[2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide.
| Compound Name | N-[3-[2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 18900060 |
| Molecular Formula | C31H24N4O5S2 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | N-[3-[2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxo-1-phenylethyl]sulfanylphenyl]-3-nitrobenzamide |
| SMILES | COc1ccc(-c2csc(NC(=O)C(Sc3cccc(NC(=O)c4cccc([N+](=O)[O-])c4)c3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C31H24N4O5S2/c1-40-25-15-13-20(14-16-25)27-19-41-31(33-27)34-30(37)28(21-7-3-2-4-8-21)42-26-12-6-10-23(18-26)32-29(36)22-9-5-11-24(17-22)35(38)39/h2-19,28H,1H3,(H,32,36)(H,33,34,37) |
| InChIKey | JTJPNOBKJHKWGZ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|