C15H14F3N5O2S3 — CID 25104099
2-[2-oxo-2-[2-[[2-(trifluoromethyl)phenyl]carbamothioyl]hydrazinyl]ethyl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 25104099) has the molecular formula C15H14F3N5O2S3 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-[2-oxo-2-[2-[[2-(trifluoromethyl)phenyl]carbamothioyl]hydrazinyl]ethyl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[2-oxo-2-[2-[[2-(trifluoromethyl)phenyl]carbamothioyl]hydrazinyl]ethyl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 25104099 |
| Molecular Formula | C15H14F3N5O2S3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | 2-[2-oxo-2-[2-[[2-(trifluoromethyl)phenyl]carbamothioyl]hydrazinyl]ethyl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CSCC(=O)Nc1nccs1)NNC(=S)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H14F3N5O2S3/c16-15(17,18)9-3-1-2-4-10(9)20-13(26)23-22-12(25)8-27-7-11(24)21-14-19-5-6-28-14/h1-6H,7-8H2,(H,22,25)(H,19,21,24)(H2,20,23,26) |
| InChIKey | KMBSBMGNGUXVQF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|