C12H12F3N3OS — CID 2730250
1-(cyclopropanecarbonylamino)-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 2730250) has the molecular formula C12H12F3N3OS and a molecular weight of 303.31 g/mol. Its IUPAC name is 1-(cyclopropanecarbonylamino)-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(cyclopropanecarbonylamino)-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2730250 |
| Molecular Formula | C12H12F3N3OS |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-(cyclopropanecarbonylamino)-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | O=C(NNC(=S)Nc1ccccc1C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C12H12F3N3OS/c13-12(14,15)8-3-1-2-4-9(8)16-11(20)18-17-10(19)7-5-6-7/h1-4,7H,5-6H2,(H,17,19)(H2,16,18,20) |
| InChIKey | YJJNKOCOJUTALH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|