C14H14F3NO3 — CID 103549795
3-[[2-(trifluoromethyl)phenyl]carbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 103549795) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is 3-[[2-(trifluoromethyl)phenyl]carbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | 3-[[2-(trifluoromethyl)phenyl]carbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103549795 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-[[2-(trifluoromethyl)phenyl]carbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)Nc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C14H14F3NO3/c15-14(16,17)10-3-1-2-4-11(10)18-12(19)8-5-6-9(7-8)13(20)21/h1-4,8-9H,5-7H2,(H,18,19)(H,20,21) |
| InChIKey | CMYFZILENNECSX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |