C19H18F4N2O — CID 17152558
1-(2-fluorophenyl)-N-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide (PubChem CID 17152558) has the molecular formula C19H18F4N2O and a molecular weight of 366.36 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17152558 |
| Molecular Formula | C19H18F4N2O |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[2-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)C1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H18F4N2O/c20-15-6-2-4-8-17(15)25-11-9-13(10-12-25)18(26)24-16-7-3-1-5-14(16)19(21,22)23/h1-8,13H,9-12H2,(H,24,26) |
| InChIKey | KZFCSEDZKGYHLA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |