C20H23FN2O — CID 17152605
N-(3,4-dimethylphenyl)-1-(2-fluorophenyl)piperidine-4-carboxamide (PubChem CID 17152605) has the molecular formula C20H23FN2O and a molecular weight of 326.42 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-1-(2-fluorophenyl)piperidine-4-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-1-(2-fluorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17152605 |
| Molecular Formula | C20H23FN2O |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | N-(3,4-dimethylphenyl)-1-(2-fluorophenyl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCN(c3ccccc3F)CC2)cc1C |
| InChI | InChI=1S/C20H23FN2O/c1-14-7-8-17(13-15(14)2)22-20(24)16-9-11-23(12-10-16)19-6-4-3-5-18(19)21/h3-8,13,16H,9-12H2,1-2H3,(H,22,24) |
| InChIKey | MGOBOTUELNKQAQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |